Бутилпарабен Butyl Palmitate
butyl palmitate
Product Name: butyl palmitate
Synonyms: Palmitic acid n-butyl ester; butyl hexadecanoate
CAS RN.: 111-06-8
EINECS: 203-829-8
Molecular Weight: 312.5304
Molecular Formula: C20H40O2
Density: 0.862g/cm3
Boiling Point(℃): 362.4°C at 760 mmHg
Flash Point(℃): 176.4°C
refractive_index: 1.445
Другие товары поставщика
|
|
Бутилпарабен Butyl Palmitate |
butyl palmitate
Product Name: butyl palmitate
Synonyms: Palmitic acid n-butyl ester; butyl hexadecanoate
CAS RN.: 111-06-8
EINECS: 203-829-8
Mo... |
|
|
Methyl oleate |
1. Methyl Oleate 2. Pale yellow oily liquid 3. CAS No.: 112-62-9 4. MOQ: 1 liter
Methyl Oleate
Molecular formula: CH3(CH2)7CH=CH(CH2)7COOCH3
Mole... |
|
|
Эрукамид Erucamide Китай |
View Enlarge Image
Erucamide (slip Agent) Cas:112-84-5[Erucamide, Xinxuamide-ER, Slip agent] ChinaPlace of Origin:Nanjing FOB Price :Get Latest... |
|
|
Methyl Stearate |
1.Product Name:Methyl Stearate2.MF:C19H38O23.Purity:98%min4.CAS No.:112-61-85.EINECS No.:203-990-4Specification:Product Name Methyl stearateSap... |
|
|
Бензиловый спирт |
Benzyl alcohol is a good middle boiling point solvent. The main applications:
paint solvent; ink solvent; plexiglass solvent; photographic developi... |
Все товары поставщика
Похожие товары
