Ethyl caprylate
•Formula:
•C9H18O2
•Molecular Weight:
•158.24
•Synonyms:
•Methyl caprylate;Methyl n-octanoate;
•EINECS:
•203-835-0
•Density:
•0.876 g/cm3
•Melting Point:
•-40 °C
•Boiling Point:
•191.1 °C at 760 mmHg
•Flash Point:
•72.8 °C
•Solubility:
•Insoluble in water
•Appearance:
•clear colorless liquid
Other supplier products
|
|
Ethyl oleate |
Specifications
1.product name: ethyl oleate
2.CAS NO.111-62-6
3.through ISO9001:2008
4.high quality and best price
Product Name
Ethyl ol... |
|
|
Butyl Oleate |
Product Description
Name:Butyl OleateMolecular formula: C22H42O2Molecular weight: 338.57Appearance: Faint yellow liquid
Density:0.87 g/cm3
Melt... |
|
|
Methyl oleate |
1. Methyl Oleate 2. Pale yellow oily liquid 3. CAS No.: 112-62-9 4. MOQ: 1 liter
Methyl Oleate
Molecular formula: CH3(CH2)7CH=CH(CH2)7COOCH3
Mole... |
|
|
Butyl Palmitate |
butyl palmitate
Product Name: butyl palmitate
Synonyms: Palmitic acid n-butyl ester; butyl hexadecanoate
CAS RN.: 111-06-8
EINECS: 203-829-8
Mo... |
|
|
benzyl alcohol |
Benzyl alcohol is a good middle boiling point solvent. The main applications:
paint solvent; ink solvent; plexiglass solvent; photographic developi... |
供应产品
Same products
